C18H26O — CID 68856676
(8R,9S,10S,13S,14S,17S)-1-methylidene-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 68856676) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S,17S)-1-methylidene-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,10S,13S,14S,17S)-1-methylidene-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 68856676 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (8R,9S,10S,13S,14S,17S)-1-methylidene-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C=C1CCC=C2CC[C@H]3[C@@H]4CC[C@H](O)[C@H]4CC[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C18H26O/c1-11-3-2-4-12-5-6-14-13-9-10-17(19)15(13)7-8-16(14)18(11)12/h4,13-19H,1-3,5-10H2/t13-,14-,15-,16-,17-,18-/m0/s1 |
| InChIKey | BBQQQGJSRCAWGJ-QQCJEOGWSA-N |
| XLogP | 4.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|