About 2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one
2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one (PubChem CID 68856842) has the molecular formula C17H24O8
and a molecular weight of 356.37 g/mol. Its IUPAC name is 2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
| PubChem CID | 68856842 |
| Molecular Formula | C17H24O8 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
| SMILES | C=C(C)C1CC=C(C)C(=O)C1.COC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H14O.C7H10O7/c1-7(2)9-5-4-8(3)10(11)6-9;1-14-5(10)3-7(13,6(11)12)2-4(8)9/h4,9H,1,5-6H2,2-3H3;13H,2-3H2,1H3,(H,8,9)(H,11,12) |
| InChIKey | LYKNJWQYBFFRFA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one?
The IUPAC name of 2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one (CID 68856842) is 2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one.
What is the SMILES notation for 2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one?
The canonical SMILES for 2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one is C=C(C)C1CC=C(C)C(=O)C1.COC(=O)CC(O)(CC(=O)O)C(=O)O.
What is the InChIKey of 2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one?
The InChIKey is LYKNJWQYBFFRFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C7H10O7/c1-7(2)9-5-4-8(3)10(11)6-9;1-14-5(10)3-7(13,6(11)12)2-4(8)9/h4,9H,1,5-6H2,2-3H3;13H,2-3H2,1H3,(H,8,9)(H,11,12).
What are the key properties of 2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one?
2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one has a molecular weight of 356.37 g/mol, XLogP of 1.33, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(2-methoxy-2-oxoethyl)butanedioic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one is sourced from PubChem (CID 68856842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).