About 5-fluoro-2,3-dihydro-1H-inden-2-ol
5-fluoro-2,3-dihydro-1H-inden-2-ol (PubChem CID 68857063) has the molecular formula C9H9FO
and a molecular weight of 152.17 g/mol. Its IUPAC name is 5-fluoro-2,3-dihydro-1H-inden-2-ol.
Molecular Properties
| Compound Name | 5-fluoro-2,3-dihydro-1H-inden-2-ol |
| PubChem CID | 68857063 |
| Molecular Formula | C9H9FO |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 5-fluoro-2,3-dihydro-1H-inden-2-ol |
| SMILES | OC1Cc2ccc(F)cc2C1 |
| InChI | InChI=1S/C9H9FO/c10-8-2-1-6-4-9(11)5-7(6)3-8/h1-3,9,11H,4-5H2 |
| InChIKey | OTJQIDXHQLVRFJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-2,3-dihydro-1H-inden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,3-dihydro-1H-inden-2-ol?
The IUPAC name of 5-fluoro-2,3-dihydro-1H-inden-2-ol (CID 68857063) is 5-fluoro-2,3-dihydro-1H-inden-2-ol.
What is the SMILES notation for 5-fluoro-2,3-dihydro-1H-inden-2-ol?
The canonical SMILES for 5-fluoro-2,3-dihydro-1H-inden-2-ol is OC1Cc2ccc(F)cc2C1.
What is the InChIKey of 5-fluoro-2,3-dihydro-1H-inden-2-ol?
The InChIKey is OTJQIDXHQLVRFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FO/c10-8-2-1-6-4-9(11)5-7(6)3-8/h1-3,9,11H,4-5H2.
What are the key properties of 5-fluoro-2,3-dihydro-1H-inden-2-ol?
5-fluoro-2,3-dihydro-1H-inden-2-ol has a molecular weight of 152.17 g/mol, XLogP of 1.29, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,3-dihydro-1H-inden-2-ol is sourced from PubChem (CID 68857063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).