About 1-bromo-3-(2,2-diethoxyethyl)benzene
1-bromo-3-(2,2-diethoxyethyl)benzene (PubChem CID 68857318) has the molecular formula C12H17BrO2
and a molecular weight of 273.17 g/mol. Its IUPAC name is 1-bromo-3-(2,2-diethoxyethyl)benzene.
Molecular Properties
| Compound Name | 1-bromo-3-(2,2-diethoxyethyl)benzene |
| PubChem CID | 68857318 |
| Molecular Formula | C12H17BrO2 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 1-bromo-3-(2,2-diethoxyethyl)benzene |
| SMILES | CCOC(Cc1cccc(Br)c1)OCC |
| InChI | InChI=1S/C12H17BrO2/c1-3-14-12(15-4-2)9-10-6-5-7-11(13)8-10/h5-8,12H,3-4,9H2,1-2H3 |
| InChIKey | WJHTWMDUJGNNHX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3-(2,2-diethoxyethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-(2,2-diethoxyethyl)benzene?
The IUPAC name of 1-bromo-3-(2,2-diethoxyethyl)benzene (CID 68857318) is 1-bromo-3-(2,2-diethoxyethyl)benzene.
What is the SMILES notation for 1-bromo-3-(2,2-diethoxyethyl)benzene?
The canonical SMILES for 1-bromo-3-(2,2-diethoxyethyl)benzene is CCOC(Cc1cccc(Br)c1)OCC.
What is the InChIKey of 1-bromo-3-(2,2-diethoxyethyl)benzene?
The InChIKey is WJHTWMDUJGNNHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrO2/c1-3-14-12(15-4-2)9-10-6-5-7-11(13)8-10/h5-8,12H,3-4,9H2,1-2H3.
What are the key properties of 1-bromo-3-(2,2-diethoxyethyl)benzene?
1-bromo-3-(2,2-diethoxyethyl)benzene has a molecular weight of 273.17 g/mol, XLogP of 3.39, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-(2,2-diethoxyethyl)benzene is sourced from PubChem (CID 68857318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).