C7H13N3S — CID 68857792
2,3,4,5,6,7-hexahydro-1,3-benzothiazole-2,6-diamine (PubChem CID 68857792) has the molecular formula C7H13N3S and a molecular weight of 171.27 g/mol. Its IUPAC name is 2,3,4,5,6,7-hexahydro-1,3-benzothiazole-2,6-diamine.
| Compound Name | 2,3,4,5,6,7-hexahydro-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 68857792 |
| Molecular Formula | C7H13N3S |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 2,3,4,5,6,7-hexahydro-1,3-benzothiazole-2,6-diamine |
| SMILES | NC1CCC2=C(C1)SC(N)N2 |
| InChI | InChI=1S/C7H13N3S/c8-4-1-2-5-6(3-4)11-7(9)10-5/h4,7,10H,1-3,8-9H2 |
| InChIKey | VFIOUFFEUGMOTK-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |