C17H18O2 — CID 68857927
(4aR)-7-hydroxy-4a-prop-2-enyl-3,4,9,10-tetrahydrophenanthren-2-one (PubChem CID 68857927) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is (4aR)-7-hydroxy-4a-prop-2-enyl-3,4,9,10-tetrahydrophenanthren-2-one.
| Compound Name | (4aR)-7-hydroxy-4a-prop-2-enyl-3,4,9,10-tetrahydrophenanthren-2-one |
|---|---|
| PubChem CID | 68857927 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (4aR)-7-hydroxy-4a-prop-2-enyl-3,4,9,10-tetrahydrophenanthren-2-one |
| SMILES | C=CC[C@]12CCC(=O)C=C1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C17H18O2/c1-2-8-17-9-7-15(19)11-13(17)4-3-12-10-14(18)5-6-16(12)17/h2,5-6,10-11,18H,1,3-4,7-9H2/t17-/m0/s1 |
| InChIKey | UDQVZDRVEBCSPZ-KRWDZBQOSA-N |
| XLogP | 3.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|