C14H11F3NO3S- — CID 68858285
2-methoxy-1-(sulfinatoamino)-4-[4-(trifluoromethyl)phenyl]benzene (PubChem CID 68858285) has the molecular formula C14H11F3NO3S- and a molecular weight of 330.31 g/mol. Its IUPAC name is 2-methoxy-1-(sulfinatoamino)-4-[4-(trifluoromethyl)phenyl]benzene.
| Compound Name | 2-methoxy-1-(sulfinatoamino)-4-[4-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 68858285 |
| Molecular Formula | C14H11F3NO3S- |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 2-methoxy-1-(sulfinatoamino)-4-[4-(trifluoromethyl)phenyl]benzene |
| SMILES | COc1cc(-c2ccc(C(F)(F)F)cc2)ccc1NS(=O)[O-] |
| InChI | InChI=1S/C14H12F3NO3S/c1-21-13-8-10(4-7-12(13)18-22(19)20)9-2-5-11(6-3-9)14(15,16)17/h2-8,18H,1H3,(H,19,20)/p-1 |
| InChIKey | TUUZUSLPRKJCKK-UHFFFAOYSA-M |
| XLogP | 3.59 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|