About 5-[(2-chloro-3,5-dimethoxyphenyl)iminomethyl]-N-ethyl-2-methylsulfanylpyrimidin-4-amine
5-[(2-chloro-3,5-dimethoxyphenyl)iminomethyl]-N-ethyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 68859265) has the molecular formula C16H19ClN4O2S
and a molecular weight of 366.87 g/mol. Its IUPAC name is 5-[(2-chloro-3,5-dimethoxyphenyl)iminomethyl]-N-ethyl-2-methylsulfanylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-[(2-chloro-3,5-dimethoxyphenyl)iminomethyl]-N-ethyl-2-methylsulfanylpyrimidin-4-amine |
| PubChem CID | 68859265 |
| Molecular Formula | C16H19ClN4O2S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 5-[(2-chloro-3,5-dimethoxyphenyl)iminomethyl]-N-ethyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CCNc1nc(SC)ncc1/C=N/c1cc(OC)cc(OC)c1Cl |
| InChI | InChI=1S/C16H19ClN4O2S/c1-5-18-15-10(9-20-16(21-15)24-4)8-19-12-6-11(22-2)7-13(23-3)14(12)17/h6-9H,5H2,1-4H3,(H,18,20,21)/b19-8+ |
| InChIKey | TYYISYFEKSVPNH-UFWORHAWSA-N |
| XLogP | 4.05 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2-chloro-3,5-dimethoxyphenyl)iminomethyl]-N-ethyl-2-methylsulfanylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-chloro-3,5-dimethoxyphenyl)iminomethyl]-N-ethyl-2-methylsulfanylpyrimidin-4-amine?
The IUPAC name of 5-[(2-chloro-3,5-dimethoxyphenyl)iminomethyl]-N-ethyl-2-methylsulfanylpyrimidin-4-amine (CID 68859265) is 5-[(2-chloro-3,5-dimethoxyphenyl)iminomethyl]-N-ethyl-2-methylsulfanylpyrimidin-4-amine.
What is the SMILES notation for 5-[(2-chloro-3,5-dimethoxyphenyl)iminomethyl]-N-ethyl-2-methylsulfanylpyrimidin-4-amine?
The canonical SMILES for 5-[(2-chloro-3,5-dimethoxyphenyl)iminomethyl]-N-ethyl-2-methylsulfanylpyrimidin-4-amine is CCNc1nc(SC)ncc1/C=N/c1cc(OC)cc(OC)c1Cl.
What is the InChIKey of 5-[(2-chloro-3,5-dimethoxyphenyl)iminomethyl]-N-ethyl-2-methylsulfanylpyrimidin-4-amine?
The InChIKey is TYYISYFEKSVPNH-UFWORHAWSA-N. The full InChI is InChI=1S/C16H19ClN4O2S/c1-5-18-15-10(9-20-16(21-15)24-4)8-19-12-6-11(22-2)7-13(23-3)14(12)17/h6-9H,5H2,1-4H3,(H,18,20,21)/b19-8+.
What are the key properties of 5-[(2-chloro-3,5-dimethoxyphenyl)iminomethyl]-N-ethyl-2-methylsulfanylpyrimidin-4-amine?
5-[(2-chloro-3,5-dimethoxyphenyl)iminomethyl]-N-ethyl-2-methylsulfanylpyrimidin-4-amine has a molecular weight of 366.87 g/mol, XLogP of 4.05, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-chloro-3,5-dimethoxyphenyl)iminomethyl]-N-ethyl-2-methylsulfanylpyrimidin-4-amine is sourced from PubChem (CID 68859265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).