C40H46Cl2F3N7O4 — CID 68859432
1,2-bis[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]-1-(6-methyl-5-nitro-2-pyridinyl)-2-[3-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 68859432) has the molecular formula C40H46Cl2F3N7O4 and a molecular weight of 816.75 g/mol. Its IUPAC name is 1,2-bis[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]-1-(6-methyl-5-nitro-2-pyridinyl)-2-[3-(trifluoromethyl)-2-pyridinyl]hydrazine.
| Compound Name | 1,2-bis[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]-1-(6-methyl-5-nitro-2-pyridinyl)-2-[3-(trifluoromethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 68859432 |
| Molecular Formula | C40H46Cl2F3N7O4 |
| Molecular Weight | 816.75 g/mol |
| Exact Mass | 815.29 |
| IUPAC Name | 1,2-bis[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]-1-(6-methyl-5-nitro-2-pyridinyl)-2-[3-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | CCOc1cc(CN2CCC(N(c3ccc([N+](=O)[O-])c(C)n3)N(c3ncccc3C(F)(F)F)C3CCN(Cc4ccc(Cl)c(OCC)c4)CC3)CC2)ccc1Cl |
| InChI | InChI=1S/C40H46Cl2F3N7O4/c1-4-55-36-23-28(8-10-33(36)41)25-48-19-14-30(15-20-48)50(38-13-12-35(52(53)54)27(3)47-38)51(39-32(40(43,44)45)7-6-18-46-39)31-16-21-49(22-17-31)26-29-9-11-34(42)37(24-29)56-5-2/h6-13,18,23-24,30-31H,4-5,14-17,19-22,25-26H2,1-3H3 |
| InChIKey | QYZSSOIRVQDXBZ-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 100.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.75 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|