C25H31BrN2O — CID 68859713
3-[(1S,5R)-8-(2-hydroxyethyl)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]-2,2-diphenylpropanenitrile bromide (PubChem CID 68859713) has the molecular formula C25H31BrN2O and a molecular weight of 455.44 g/mol. Its IUPAC name is 3-[(1S,5R)-8-(2-hydroxyethyl)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]-2,2-diphenylpropanenitrile bromide.
| Compound Name | 3-[(1S,5R)-8-(2-hydroxyethyl)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]-2,2-diphenylpropanenitrile bromide |
|---|---|
| PubChem CID | 68859713 |
| Molecular Formula | C25H31BrN2O |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 3-[(1S,5R)-8-(2-hydroxyethyl)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]-2,2-diphenylpropanenitrile bromide |
| SMILES | C[N+]1(CCO)[C@@H]2CC[C@H]1CC(CC(C#N)(c1ccccc1)c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C25H31N2O.BrH/c1-27(14-15-28)23-12-13-24(27)17-20(16-23)18-25(19-26,21-8-4-2-5-9-21)22-10-6-3-7-11-22;/h2-11,20,23-24,28H,12-18H2,1H3;1H/q+1;/p-1/t20?,23-,24+,27?; |
| InChIKey | PTQXFWGMBXUWMO-OHUBXKMSSA-M |
| XLogP | 1.27 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|