About 3-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine
3-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine (PubChem CID 68859845) has the molecular formula C24H22FNS
and a molecular weight of 375.51 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine.
Molecular Properties
| Compound Name | 3-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine |
| PubChem CID | 68859845 |
| Molecular Formula | C24H22FNS |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine |
| SMILES | Cc1ccc(/N=C/C=C(Sc2ccc(F)cc2)c2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C24H22FNS/c1-17-4-8-22(9-5-17)26-13-12-24(20-15-18(2)14-19(3)16-20)27-23-10-6-21(25)7-11-23/h4-16H,1-3H3/b24-12?,26-13+ |
| InChIKey | BIBHCGCZMBCUJB-JMNMEVSRSA-N |
| XLogP | 7.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine?
The IUPAC name of 3-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine (CID 68859845) is 3-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine.
What is the SMILES notation for 3-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine?
The canonical SMILES for 3-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine is Cc1ccc(/N=C/C=C(Sc2ccc(F)cc2)c2cc(C)cc(C)c2)cc1.
What is the InChIKey of 3-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine?
The InChIKey is BIBHCGCZMBCUJB-JMNMEVSRSA-N. The full InChI is InChI=1S/C24H22FNS/c1-17-4-8-22(9-5-17)26-13-12-24(20-15-18(2)14-19(3)16-20)27-23-10-6-21(25)7-11-23/h4-16H,1-3H3/b24-12?,26-13+.
What are the key properties of 3-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine?
3-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine has a molecular weight of 375.51 g/mol, XLogP of 7.29, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethylphenyl)-3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-en-1-imine is sourced from PubChem (CID 68859845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).