C26H30N4O2S — CID 68860210
N-[4-[6-(4-cyclopentylpiperazin-1-yl)-3-pyridinyl]phenyl]benzenesulfonamide (PubChem CID 68860210) has the molecular formula C26H30N4O2S and a molecular weight of 462.62 g/mol. Its IUPAC name is N-[4-[6-(4-cyclopentylpiperazin-1-yl)-3-pyridinyl]phenyl]benzenesulfonamide.
| Compound Name | N-[4-[6-(4-cyclopentylpiperazin-1-yl)-3-pyridinyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 68860210 |
| Molecular Formula | C26H30N4O2S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | N-[4-[6-(4-cyclopentylpiperazin-1-yl)-3-pyridinyl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2ccc(N3CCN(C4CCCC4)CC3)nc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H30N4O2S/c31-33(32,25-8-2-1-3-9-25)28-23-13-10-21(11-14-23)22-12-15-26(27-20-22)30-18-16-29(17-19-30)24-6-4-5-7-24/h1-3,8-15,20,24,28H,4-7,16-19H2 |
| InChIKey | QCVNBKFFPIFDDW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |