About 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carboxylic acid
6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carboxylic acid (PubChem CID 68860523) has the molecular formula C22H29N3O4
and a molecular weight of 399.49 g/mol. Its IUPAC name is 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carboxylic acid |
| PubChem CID | 68860523 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carboxylic acid |
| SMILES | CCOc1cc(CN(c2ccc(C(=O)O)cn2)C2CCNCC2)cc(OCC)c1 |
| InChI | InChI=1S/C22H29N3O4/c1-3-28-19-11-16(12-20(13-19)29-4-2)15-25(18-7-9-23-10-8-18)21-6-5-17(14-24-21)22(26)27/h5-6,11-14,18,23H,3-4,7-10,15H2,1-2H3,(H,26,27) |
| InChIKey | GJZOVIDDTHAEIH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carboxylic acid?
The IUPAC name of 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carboxylic acid (CID 68860523) is 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carboxylic acid.
What is the SMILES notation for 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carboxylic acid?
The canonical SMILES for 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carboxylic acid is CCOc1cc(CN(c2ccc(C(=O)O)cn2)C2CCNCC2)cc(OCC)c1.
What is the InChIKey of 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carboxylic acid?
The InChIKey is GJZOVIDDTHAEIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3O4/c1-3-28-19-11-16(12-20(13-19)29-4-2)15-25(18-7-9-23-10-8-18)21-6-5-17(14-24-21)22(26)27/h5-6,11-14,18,23H,3-4,7-10,15H2,1-2H3,(H,26,27).
What are the key properties of 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carboxylic acid?
6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carboxylic acid has a molecular weight of 399.49 g/mol, XLogP of 3.34, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carboxylic acid is sourced from PubChem (CID 68860523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).