About [2-cyano-4-[[(3,4-diphenylfuran-2-carbonyl)amino]carbamoyl]phenyl] acetate
[2-cyano-4-[[(3,4-diphenylfuran-2-carbonyl)amino]carbamoyl]phenyl] acetate (PubChem CID 68860564) has the molecular formula C27H19N3O5
and a molecular weight of 465.47 g/mol. Its IUPAC name is [2-cyano-4-[[(3,4-diphenylfuran-2-carbonyl)amino]carbamoyl]phenyl] acetate.
Molecular Properties
| Compound Name | [2-cyano-4-[[(3,4-diphenylfuran-2-carbonyl)amino]carbamoyl]phenyl] acetate |
| PubChem CID | 68860564 |
| Molecular Formula | C27H19N3O5 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | [2-cyano-4-[[(3,4-diphenylfuran-2-carbonyl)amino]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)NNC(=O)c2occ(-c3ccccc3)c2-c2ccccc2)cc1C#N |
| InChI | InChI=1S/C27H19N3O5/c1-17(31)35-23-13-12-20(14-21(23)15-28)26(32)29-30-27(33)25-24(19-10-6-3-7-11-19)22(16-34-25)18-8-4-2-5-9-18/h2-14,16H,1H3,(H,29,32)(H,30,33) |
| InChIKey | SPHCPZDYWJZGSH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-cyano-4-[[(3,4-diphenylfuran-2-carbonyl)amino]carbamoyl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-cyano-4-[[(3,4-diphenylfuran-2-carbonyl)amino]carbamoyl]phenyl] acetate?
The IUPAC name of [2-cyano-4-[[(3,4-diphenylfuran-2-carbonyl)amino]carbamoyl]phenyl] acetate (CID 68860564) is [2-cyano-4-[[(3,4-diphenylfuran-2-carbonyl)amino]carbamoyl]phenyl] acetate.
What is the SMILES notation for [2-cyano-4-[[(3,4-diphenylfuran-2-carbonyl)amino]carbamoyl]phenyl] acetate?
The canonical SMILES for [2-cyano-4-[[(3,4-diphenylfuran-2-carbonyl)amino]carbamoyl]phenyl] acetate is CC(=O)Oc1ccc(C(=O)NNC(=O)c2occ(-c3ccccc3)c2-c2ccccc2)cc1C#N.
What is the InChIKey of [2-cyano-4-[[(3,4-diphenylfuran-2-carbonyl)amino]carbamoyl]phenyl] acetate?
The InChIKey is SPHCPZDYWJZGSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19N3O5/c1-17(31)35-23-13-12-20(14-21(23)15-28)26(32)29-30-27(33)25-24(19-10-6-3-7-11-19)22(16-34-25)18-8-4-2-5-9-18/h2-14,16H,1H3,(H,29,32)(H,30,33).
What are the key properties of [2-cyano-4-[[(3,4-diphenylfuran-2-carbonyl)amino]carbamoyl]phenyl] acetate?
[2-cyano-4-[[(3,4-diphenylfuran-2-carbonyl)amino]carbamoyl]phenyl] acetate has a molecular weight of 465.47 g/mol, XLogP of 4.49, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-cyano-4-[[(3,4-diphenylfuran-2-carbonyl)amino]carbamoyl]phenyl] acetate is sourced from PubChem (CID 68860564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).