C20H18N8O3 — CID 6886063
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-[(E)-3-(furan-2-yl)-2-methylprop-2-enylidene]amino]-5-(4-methylphenyl)triazole-4-carboxamide (PubChem CID 6886063) has the molecular formula C20H18N8O3 and a molecular weight of 418.42 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-[(E)-3-(furan-2-yl)-2-methylprop-2-enylidene]amino]-5-(4-methylphenyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-[(E)-3-(furan-2-yl)-2-methylprop-2-enylidene]amino]-5-(4-methylphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 6886063 |
| Molecular Formula | C20H18N8O3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-[(E)-3-(furan-2-yl)-2-methylprop-2-enylidene]amino]-5-(4-methylphenyl)triazole-4-carboxamide |
| SMILES | CC(/C=N/NC(=O)c1nnn(-c2nonc2N)c1-c1ccc(C)cc1)=C\c1ccco1 |
| InChI | InChI=1S/C20H18N8O3/c1-12-5-7-14(8-6-12)17-16(23-27-28(17)19-18(21)25-31-26-19)20(29)24-22-11-13(2)10-15-4-3-9-30-15/h3-11H,1-2H3,(H2,21,25)(H,24,29)/b13-10+,22-11+ |
| InChIKey | LPJHZRRJVYBZHN-WMBBNROFSA-N |
| XLogP | 2.62 |
| TPSA | 150.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|