C6H13O6P — CID 68860724
(2R,3R,5S,6R)-1-phosphanylcyclohexane-1,2,3,4,5,6-hexol (PubChem CID 68860724) has the molecular formula C6H13O6P and a molecular weight of 212.14 g/mol. Its IUPAC name is (2R,3R,5S,6R)-1-phosphanylcyclohexane-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3R,5S,6R)-1-phosphanylcyclohexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 68860724 |
| Molecular Formula | C6H13O6P |
| Molecular Weight | 212.14 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | (2R,3R,5S,6R)-1-phosphanylcyclohexane-1,2,3,4,5,6-hexol |
| SMILES | OC1[C@@H](O)[C@@H](O)C(O)(P)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H13O6P/c7-1-2(8)4(10)6(12,13)5(11)3(1)9/h1-5,7-12H,13H2/t1?,2-,3+,4-,5-,6?/m1/s1 |
| InChIKey | VEHKXBDIKVQEIM-GCVPSNMTSA-N |
| XLogP | -3.63 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.14 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|