C31H32ClN5S — CID 68861164
7-chloro-2-[5-(1H-indol-5-yl)thiophen-2-yl]-N-[2-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-3-yl)ethyl]quinazolin-4-amine (PubChem CID 68861164) has the molecular formula C31H32ClN5S and a molecular weight of 542.15 g/mol. Its IUPAC name is 7-chloro-2-[5-(1H-indol-5-yl)thiophen-2-yl]-N-[2-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-3-yl)ethyl]quinazolin-4-amine.
| Compound Name | 7-chloro-2-[5-(1H-indol-5-yl)thiophen-2-yl]-N-[2-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-3-yl)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 68861164 |
| Molecular Formula | C31H32ClN5S |
| Molecular Weight | 542.15 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 7-chloro-2-[5-(1H-indol-5-yl)thiophen-2-yl]-N-[2-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-3-yl)ethyl]quinazolin-4-amine |
| SMILES | CN1CC(CCNc2nc(-c3ccc(-c4ccc5[nH]ccc5c4)s3)nc3cc(Cl)ccc23)C2CCCCC21 |
| InChI | InChI=1S/C31H32ClN5S/c1-37-18-21(23-4-2-3-5-27(23)37)13-15-34-30-24-8-7-22(32)17-26(24)35-31(36-30)29-11-10-28(38-29)20-6-9-25-19(16-20)12-14-33-25/h6-12,14,16-17,21,23,27,33H,2-5,13,15,18H2,1H3,(H,34,35,36) |
| InChIKey | PDSDPYFWEBSHMZ-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.15 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |