C37H52N6O9S — CID 68861901
[4-(cyclopentylsulfamoylcarbamoyl)-14-[(2-methylpropan-2-yl)oxycarbonylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 1,3-dihydroisoindole-2-carboxylate (PubChem CID 68861901) has the molecular formula C37H52N6O9S and a molecular weight of 756.92 g/mol. Its IUPAC name is [4-(cyclopentylsulfamoylcarbamoyl)-14-[(2-methylpropan-2-yl)oxycarbonylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 1,3-dihydroisoindole-2-carboxylate.
| Compound Name | [4-(cyclopentylsulfamoylcarbamoyl)-14-[(2-methylpropan-2-yl)oxycarbonylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 68861901 |
| Molecular Formula | C37H52N6O9S |
| Molecular Weight | 756.92 g/mol |
| Exact Mass | 756.35 |
| IUPAC Name | [4-(cyclopentylsulfamoylcarbamoyl)-14-[(2-methylpropan-2-yl)oxycarbonylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 1,3-dihydroisoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)NC1CCCCCC=CC2CC2(C(=O)NS(=O)(=O)NC2CCCC2)NC(=O)C2CC(OC(=O)N3Cc4ccccc4C3)CN2C1=O |
| InChI | InChI=1S/C37H52N6O9S/c1-36(2,3)52-34(47)38-29-18-8-6-4-5-7-15-26-20-37(26,33(46)41-53(49,50)40-27-16-11-12-17-27)39-31(44)30-19-28(23-43(30)32(29)45)51-35(48)42-21-24-13-9-10-14-25(24)22-42/h7,9-10,13-15,26-30,40H,4-6,8,11-12,16-23H2,1-3H3,(H,38,47)(H,39,44)(H,41,46) |
| InChIKey | PCPWFSVMFGUAQR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 192.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.92 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|