About 3,4-bis(4-chlorophenyl)-N'-(3-cyano-4-hydroxybenzoyl)furan-2-carbohydrazide
3,4-bis(4-chlorophenyl)-N'-(3-cyano-4-hydroxybenzoyl)furan-2-carbohydrazide (PubChem CID 68861944) has the molecular formula C25H15Cl2N3O4
and a molecular weight of 492.32 g/mol. Its IUPAC name is 3,4-bis(4-chlorophenyl)-N'-(3-cyano-4-hydroxybenzoyl)furan-2-carbohydrazide.
Molecular Properties
| Compound Name | 3,4-bis(4-chlorophenyl)-N'-(3-cyano-4-hydroxybenzoyl)furan-2-carbohydrazide |
| PubChem CID | 68861944 |
| Molecular Formula | C25H15Cl2N3O4 |
| Molecular Weight | 492.32 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | 3,4-bis(4-chlorophenyl)-N'-(3-cyano-4-hydroxybenzoyl)furan-2-carbohydrazide |
| SMILES | N#Cc1cc(C(=O)NNC(=O)c2occ(-c3ccc(Cl)cc3)c2-c2ccc(Cl)cc2)ccc1O |
| InChI | InChI=1S/C25H15Cl2N3O4/c26-18-6-1-14(2-7-18)20-13-34-23(22(20)15-3-8-19(27)9-4-15)25(33)30-29-24(32)16-5-10-21(31)17(11-16)12-28/h1-11,13,31H,(H,29,32)(H,30,33) |
| InChIKey | OYEMFBQWFCHTRT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.32 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(4-chlorophenyl)-N'-(3-cyano-4-hydroxybenzoyl)furan-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(4-chlorophenyl)-N'-(3-cyano-4-hydroxybenzoyl)furan-2-carbohydrazide?
The IUPAC name of 3,4-bis(4-chlorophenyl)-N'-(3-cyano-4-hydroxybenzoyl)furan-2-carbohydrazide (CID 68861944) is 3,4-bis(4-chlorophenyl)-N'-(3-cyano-4-hydroxybenzoyl)furan-2-carbohydrazide.
What is the SMILES notation for 3,4-bis(4-chlorophenyl)-N'-(3-cyano-4-hydroxybenzoyl)furan-2-carbohydrazide?
The canonical SMILES for 3,4-bis(4-chlorophenyl)-N'-(3-cyano-4-hydroxybenzoyl)furan-2-carbohydrazide is N#Cc1cc(C(=O)NNC(=O)c2occ(-c3ccc(Cl)cc3)c2-c2ccc(Cl)cc2)ccc1O.
What is the InChIKey of 3,4-bis(4-chlorophenyl)-N'-(3-cyano-4-hydroxybenzoyl)furan-2-carbohydrazide?
The InChIKey is OYEMFBQWFCHTRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H15Cl2N3O4/c26-18-6-1-14(2-7-18)20-13-34-23(22(20)15-3-8-19(27)9-4-15)25(33)30-29-24(32)16-5-10-21(31)17(11-16)12-28/h1-11,13,31H,(H,29,32)(H,30,33).
What are the key properties of 3,4-bis(4-chlorophenyl)-N'-(3-cyano-4-hydroxybenzoyl)furan-2-carbohydrazide?
3,4-bis(4-chlorophenyl)-N'-(3-cyano-4-hydroxybenzoyl)furan-2-carbohydrazide has a molecular weight of 492.32 g/mol, XLogP of 5.57, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(4-chlorophenyl)-N'-(3-cyano-4-hydroxybenzoyl)furan-2-carbohydrazide is sourced from PubChem (CID 68861944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).