C14H20O4 — CID 68862113
3,6-bis(pent-4-enyl)-1,4-dioxane-2,5-dione (PubChem CID 68862113) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3,6-bis(pent-4-enyl)-1,4-dioxane-2,5-dione.
| Compound Name | 3,6-bis(pent-4-enyl)-1,4-dioxane-2,5-dione |
|---|---|
| PubChem CID | 68862113 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3,6-bis(pent-4-enyl)-1,4-dioxane-2,5-dione |
| SMILES | C=CCCCC1OC(=O)C(CCCC=C)OC1=O |
| InChI | InChI=1S/C14H20O4/c1-3-5-7-9-11-13(15)18-12(14(16)17-11)10-8-6-4-2/h3-4,11-12H,1-2,5-10H2 |
| InChIKey | RYELWDPAPGHQMN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|