C25H25N5O3S2 — CID 68862277
N-[3-[[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]-(thiophene-2-carbonyl)amino]propyl]pyrrolidine-2-carboxamide (PubChem CID 68862277) has the molecular formula C25H25N5O3S2 and a molecular weight of 507.64 g/mol. Its IUPAC name is N-[3-[[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]-(thiophene-2-carbonyl)amino]propyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[3-[[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]-(thiophene-2-carbonyl)amino]propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 68862277 |
| Molecular Formula | C25H25N5O3S2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | N-[3-[[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]-(thiophene-2-carbonyl)amino]propyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCN(C(=O)c1cccs1)c1nc(-c2cc(-c3ccccc3)no2)cs1)C1CCCN1 |
| InChI | InChI=1S/C25H25N5O3S2/c31-23(18-9-4-11-26-18)27-12-6-13-30(24(32)22-10-5-14-34-22)25-28-20(16-35-25)21-15-19(29-33-21)17-7-2-1-3-8-17/h1-3,5,7-8,10,14-16,18,26H,4,6,9,11-13H2,(H,27,31) |
| InChIKey | WOCZLSAMNWILIG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|