About 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carbonitrile
6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carbonitrile (PubChem CID 68862540) has the molecular formula C22H28N4O2
and a molecular weight of 380.49 g/mol. Its IUPAC name is 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carbonitrile |
| PubChem CID | 68862540 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carbonitrile |
| SMILES | CCOc1cc(CN(c2ccc(C#N)cn2)C2CCNCC2)cc(OCC)c1 |
| InChI | InChI=1S/C22H28N4O2/c1-3-27-20-11-18(12-21(13-20)28-4-2)16-26(19-7-9-24-10-8-19)22-6-5-17(14-23)15-25-22/h5-6,11-13,15,19,24H,3-4,7-10,16H2,1-2H3 |
| InChIKey | SVDAKEXYAOQGOH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carbonitrile?
The IUPAC name of 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carbonitrile (CID 68862540) is 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carbonitrile.
What is the SMILES notation for 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carbonitrile?
The canonical SMILES for 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carbonitrile is CCOc1cc(CN(c2ccc(C#N)cn2)C2CCNCC2)cc(OCC)c1.
What is the InChIKey of 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carbonitrile?
The InChIKey is SVDAKEXYAOQGOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N4O2/c1-3-27-20-11-18(12-21(13-20)28-4-2)16-26(19-7-9-24-10-8-19)22-6-5-17(14-23)15-25-22/h5-6,11-13,15,19,24H,3-4,7-10,16H2,1-2H3.
What are the key properties of 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carbonitrile?
6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carbonitrile has a molecular weight of 380.49 g/mol, XLogP of 3.51, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,5-diethoxyphenyl)methyl-piperidin-4-ylamino]pyridine-3-carbonitrile is sourced from PubChem (CID 68862540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).