C19H20N4O2 — CID 68862680
(2R)-2-[[(1R)-1-(4-methyl-3-oxoquinoxalin-2-yl)ethyl]amino]-2-phenylacetamide (PubChem CID 68862680) has the molecular formula C19H20N4O2 and a molecular weight of 336.39 g/mol. Its IUPAC name is (2R)-2-[[(1R)-1-(4-methyl-3-oxoquinoxalin-2-yl)ethyl]amino]-2-phenylacetamide.
| Compound Name | (2R)-2-[[(1R)-1-(4-methyl-3-oxoquinoxalin-2-yl)ethyl]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 68862680 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (2R)-2-[[(1R)-1-(4-methyl-3-oxoquinoxalin-2-yl)ethyl]amino]-2-phenylacetamide |
| SMILES | C[C@@H](N[C@@H](C(N)=O)c1ccccc1)c1nc2ccccc2n(C)c1=O |
| InChI | InChI=1S/C19H20N4O2/c1-12(21-17(18(20)24)13-8-4-3-5-9-13)16-19(25)23(2)15-11-7-6-10-14(15)22-16/h3-12,17,21H,1-2H3,(H2,20,24)/t12-,17-/m1/s1 |
| InChIKey | BSDOQQIFGMHCTL-SJKOYZFVSA-N |
| XLogP | 1.81 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |