C30H26FN3 — CID 68862877
N-[(4-fluorophenyl)methyl]-1-(1H-imidazol-5-yl)-2,2,2-triphenylethanamine (PubChem CID 68862877) has the molecular formula C30H26FN3 and a molecular weight of 447.56 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-1-(1H-imidazol-5-yl)-2,2,2-triphenylethanamine.
| Compound Name | N-[(4-fluorophenyl)methyl]-1-(1H-imidazol-5-yl)-2,2,2-triphenylethanamine |
|---|---|
| PubChem CID | 68862877 |
| Molecular Formula | C30H26FN3 |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-1-(1H-imidazol-5-yl)-2,2,2-triphenylethanamine |
| SMILES | Fc1ccc(CNC(c2cnc[nH]2)C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H26FN3/c31-27-18-16-23(17-19-27)20-33-29(28-21-32-22-34-28)30(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-19,21-22,29,33H,20H2,(H,32,34) |
| InChIKey | PRDFKNOGFSUCLC-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|