About 2-(2,3,6-trifluorophenyl)ethanesulfinic acid
2-(2,3,6-trifluorophenyl)ethanesulfinic acid (PubChem CID 68862906) has the molecular formula C8H7F3O2S
and a molecular weight of 224.20 g/mol. Its IUPAC name is 2-(2,3,6-trifluorophenyl)ethanesulfinic acid.
Molecular Properties
| Compound Name | 2-(2,3,6-trifluorophenyl)ethanesulfinic acid |
| PubChem CID | 68862906 |
| Molecular Formula | C8H7F3O2S |
| Molecular Weight | 224.20 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 2-(2,3,6-trifluorophenyl)ethanesulfinic acid |
| SMILES | O=S(O)CCc1c(F)ccc(F)c1F |
| InChI | InChI=1S/C8H7F3O2S/c9-6-1-2-7(10)8(11)5(6)3-4-14(12)13/h1-2H,3-4H2,(H,12,13) |
| InChIKey | LUIHDXPCQIVNPA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3,6-trifluorophenyl)ethanesulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3,6-trifluorophenyl)ethanesulfinic acid?
The IUPAC name of 2-(2,3,6-trifluorophenyl)ethanesulfinic acid (CID 68862906) is 2-(2,3,6-trifluorophenyl)ethanesulfinic acid.
What is the SMILES notation for 2-(2,3,6-trifluorophenyl)ethanesulfinic acid?
The canonical SMILES for 2-(2,3,6-trifluorophenyl)ethanesulfinic acid is O=S(O)CCc1c(F)ccc(F)c1F.
What is the InChIKey of 2-(2,3,6-trifluorophenyl)ethanesulfinic acid?
The InChIKey is LUIHDXPCQIVNPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3O2S/c9-6-1-2-7(10)8(11)5(6)3-4-14(12)13/h1-2H,3-4H2,(H,12,13).
What are the key properties of 2-(2,3,6-trifluorophenyl)ethanesulfinic acid?
2-(2,3,6-trifluorophenyl)ethanesulfinic acid has a molecular weight of 224.20 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3,6-trifluorophenyl)ethanesulfinic acid is sourced from PubChem (CID 68862906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).