About benzenesulfinylbenzene;trichloro(methyl)silane
benzenesulfinylbenzene;trichloro(methyl)silane (PubChem CID 68863151) has the molecular formula C13H13Cl3OSSi
and a molecular weight of 351.76 g/mol. Its IUPAC name is benzenesulfinylbenzene;trichloro(methyl)silane.
Molecular Properties
| Compound Name | benzenesulfinylbenzene;trichloro(methyl)silane |
| PubChem CID | 68863151 |
| Molecular Formula | C13H13Cl3OSSi |
| Molecular Weight | 351.76 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | benzenesulfinylbenzene;trichloro(methyl)silane |
| SMILES | C[Si](Cl)(Cl)Cl.O=S(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10OS.CH3Cl3Si/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-5(2,3)4/h1-10H;1H3 |
| InChIKey | FEMYXXCBVRPCFV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.76 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfinylbenzene;trichloro(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfinylbenzene;trichloro(methyl)silane?
The IUPAC name of benzenesulfinylbenzene;trichloro(methyl)silane (CID 68863151) is benzenesulfinylbenzene;trichloro(methyl)silane.
What is the SMILES notation for benzenesulfinylbenzene;trichloro(methyl)silane?
The canonical SMILES for benzenesulfinylbenzene;trichloro(methyl)silane is C[Si](Cl)(Cl)Cl.O=S(c1ccccc1)c1ccccc1.
What is the InChIKey of benzenesulfinylbenzene;trichloro(methyl)silane?
The InChIKey is FEMYXXCBVRPCFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10OS.CH3Cl3Si/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-5(2,3)4/h1-10H;1H3.
What are the key properties of benzenesulfinylbenzene;trichloro(methyl)silane?
benzenesulfinylbenzene;trichloro(methyl)silane has a molecular weight of 351.76 g/mol, XLogP of 5.12, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfinylbenzene;trichloro(methyl)silane is sourced from PubChem (CID 68863151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).