C32H32ClN5S — CID 68863385
7-chloro-N-[2-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-3-yl)ethyl]-2-(5-quinolin-8-ylthiophen-2-yl)quinazolin-4-amine (PubChem CID 68863385) has the molecular formula C32H32ClN5S and a molecular weight of 554.16 g/mol. Its IUPAC name is 7-chloro-N-[2-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-3-yl)ethyl]-2-(5-quinolin-8-ylthiophen-2-yl)quinazolin-4-amine.
| Compound Name | 7-chloro-N-[2-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-3-yl)ethyl]-2-(5-quinolin-8-ylthiophen-2-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 68863385 |
| Molecular Formula | C32H32ClN5S |
| Molecular Weight | 554.16 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | 7-chloro-N-[2-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-3-yl)ethyl]-2-(5-quinolin-8-ylthiophen-2-yl)quinazolin-4-amine |
| SMILES | CN1CC(CCNc2nc(-c3ccc(-c4cccc5cccnc45)s3)nc3cc(Cl)ccc23)C2CCCCC21 |
| InChI | InChI=1S/C32H32ClN5S/c1-38-19-21(23-8-2-3-10-27(23)38)15-17-35-31-24-12-11-22(33)18-26(24)36-32(37-31)29-14-13-28(39-29)25-9-4-6-20-7-5-16-34-30(20)25/h4-7,9,11-14,16,18,21,23,27H,2-3,8,10,15,17,19H2,1H3,(H,35,36,37) |
| InChIKey | UITFRNKXRUOBRE-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.16 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |