About methyl 2-(2-oxospiro[3a,4-dihydroindole-3,4'-piperidine]-1-yl)acetate
methyl 2-(2-oxospiro[3a,4-dihydroindole-3,4'-piperidine]-1-yl)acetate (PubChem CID 68863608) has the molecular formula C15H20N2O3
and a molecular weight of 276.34 g/mol. Its IUPAC name is methyl 2-(2-oxospiro[3a,4-dihydroindole-3,4'-piperidine]-1-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(2-oxospiro[3a,4-dihydroindole-3,4'-piperidine]-1-yl)acetate |
| PubChem CID | 68863608 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | methyl 2-(2-oxospiro[3a,4-dihydroindole-3,4'-piperidine]-1-yl)acetate |
| SMILES | COC(=O)CN1C(=O)C2(CCNCC2)C2CC=CC=C21 |
| InChI | InChI=1S/C15H20N2O3/c1-20-13(18)10-17-12-5-3-2-4-11(12)15(14(17)19)6-8-16-9-7-15/h2-3,5,11,16H,4,6-10H2,1H3 |
| InChIKey | RQMAUHNORKWJEN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(2-oxospiro[3a,4-dihydroindole-3,4'-piperidine]-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-oxospiro[3a,4-dihydroindole-3,4'-piperidine]-1-yl)acetate?
The IUPAC name of methyl 2-(2-oxospiro[3a,4-dihydroindole-3,4'-piperidine]-1-yl)acetate (CID 68863608) is methyl 2-(2-oxospiro[3a,4-dihydroindole-3,4'-piperidine]-1-yl)acetate.
What is the SMILES notation for methyl 2-(2-oxospiro[3a,4-dihydroindole-3,4'-piperidine]-1-yl)acetate?
The canonical SMILES for methyl 2-(2-oxospiro[3a,4-dihydroindole-3,4'-piperidine]-1-yl)acetate is COC(=O)CN1C(=O)C2(CCNCC2)C2CC=CC=C21.
What is the InChIKey of methyl 2-(2-oxospiro[3a,4-dihydroindole-3,4'-piperidine]-1-yl)acetate?
The InChIKey is RQMAUHNORKWJEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-20-13(18)10-17-12-5-3-2-4-11(12)15(14(17)19)6-8-16-9-7-15/h2-3,5,11,16H,4,6-10H2,1H3.
What are the key properties of methyl 2-(2-oxospiro[3a,4-dihydroindole-3,4'-piperidine]-1-yl)acetate?
methyl 2-(2-oxospiro[3a,4-dihydroindole-3,4'-piperidine]-1-yl)acetate has a molecular weight of 276.34 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-oxospiro[3a,4-dihydroindole-3,4'-piperidine]-1-yl)acetate is sourced from PubChem (CID 68863608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).