C27H36N2O4S — CID 68864649
methyl 2-[[2-[(E)-5-(diethylamino)pent-1-enyl]phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylate (PubChem CID 68864649) has the molecular formula C27H36N2O4S and a molecular weight of 484.66 g/mol. Its IUPAC name is methyl 2-[[2-[(E)-5-(diethylamino)pent-1-enyl]phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylate.
| Compound Name | methyl 2-[[2-[(E)-5-(diethylamino)pent-1-enyl]phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 68864649 |
| Molecular Formula | C27H36N2O4S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | methyl 2-[[2-[(E)-5-(diethylamino)pent-1-enyl]phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylate |
| SMILES | CCN(CC)CCC/C=C/c1ccccc1S(=O)(=O)Nc1ccc2c(c1C(=O)OC)CCCC2 |
| InChI | InChI=1S/C27H36N2O4S/c1-4-29(5-2)20-12-6-7-14-22-15-9-11-17-25(22)34(31,32)28-24-19-18-21-13-8-10-16-23(21)26(24)27(30)33-3/h7,9,11,14-15,17-19,28H,4-6,8,10,12-13,16,20H2,1-3H3/b14-7+ |
| InChIKey | JQCLMWCBOFLJSO-VGOFMYFVSA-N |
| XLogP | 5.29 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|