C27H28ClN3O4S — CID 68865157
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione (PubChem CID 68865157) has the molecular formula C27H28ClN3O4S and a molecular weight of 526.06 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 68865157 |
| Molecular Formula | C27H28ClN3O4S |
| Molecular Weight | 526.06 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Sc3n[nH]c(-c4ccccc4)n3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C27H28ClN3O4S/c1-34-22-12-11-17(15-20(22)28)13-14-27(19-9-5-6-10-19)16-21(32)23(25(33)35-27)36-26-29-24(30-31-26)18-7-3-2-4-8-18/h2-4,7-8,11-12,15,19,23H,5-6,9-10,13-14,16H2,1H3,(H,29,30,31) |
| InChIKey | NGPMJPUYSSNHHA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.06 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|