About 3-[4-[N-(2-methoxyethyl)-N-methylcarbamimidoyl]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxamide
3-[4-[N-(2-methoxyethyl)-N-methylcarbamimidoyl]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxamide (PubChem CID 68865361) has the molecular formula C16H22N4O3
and a molecular weight of 318.38 g/mol. Its IUPAC name is 3-[4-[N-(2-methoxyethyl)-N-methylcarbamimidoyl]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-[4-[N-(2-methoxyethyl)-N-methylcarbamimidoyl]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxamide |
| PubChem CID | 68865361 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 3-[4-[N-(2-methoxyethyl)-N-methylcarbamimidoyl]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxamide |
| SMILES | [H]/N=C(/c1ccc(C2=NOC(C)(C(N)=O)C2)cc1)N(C)CCOC |
| InChI | InChI=1S/C16H22N4O3/c1-16(15(18)21)10-13(19-23-16)11-4-6-12(7-5-11)14(17)20(2)8-9-22-3/h4-7,17H,8-10H2,1-3H3,(H2,18,21)/b17-14- |
| InChIKey | WLLQEZUSPOOFSB-VKAVYKQESA-N |
| XLogP | 0.96 |
| TPSA | 101.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[N-(2-methoxyethyl)-N-methylcarbamimidoyl]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[N-(2-methoxyethyl)-N-methylcarbamimidoyl]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxamide?
The IUPAC name of 3-[4-[N-(2-methoxyethyl)-N-methylcarbamimidoyl]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxamide (CID 68865361) is 3-[4-[N-(2-methoxyethyl)-N-methylcarbamimidoyl]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxamide.
What is the SMILES notation for 3-[4-[N-(2-methoxyethyl)-N-methylcarbamimidoyl]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxamide?
The canonical SMILES for 3-[4-[N-(2-methoxyethyl)-N-methylcarbamimidoyl]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxamide is [H]/N=C(/c1ccc(C2=NOC(C)(C(N)=O)C2)cc1)N(C)CCOC.
What is the InChIKey of 3-[4-[N-(2-methoxyethyl)-N-methylcarbamimidoyl]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxamide?
The InChIKey is WLLQEZUSPOOFSB-VKAVYKQESA-N. The full InChI is InChI=1S/C16H22N4O3/c1-16(15(18)21)10-13(19-23-16)11-4-6-12(7-5-11)14(17)20(2)8-9-22-3/h4-7,17H,8-10H2,1-3H3,(H2,18,21)/b17-14-.
What are the key properties of 3-[4-[N-(2-methoxyethyl)-N-methylcarbamimidoyl]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxamide?
3-[4-[N-(2-methoxyethyl)-N-methylcarbamimidoyl]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxamide has a molecular weight of 318.38 g/mol, XLogP of 0.96, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[N-(2-methoxyethyl)-N-methylcarbamimidoyl]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 68865361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).