C9H8N4 — CID 68865416
1,4,5,11-tetrazatricyclo[7.4.0.02,7]trideca-4,6,8,10,12-pentaene (PubChem CID 68865416) has the molecular formula C9H8N4 and a molecular weight of 172.19 g/mol. Its IUPAC name is 1,4,5,11-tetrazatricyclo[7.4.0.02,7]trideca-4,6,8,10,12-pentaene.
| Compound Name | 1,4,5,11-tetrazatricyclo[7.4.0.02,7]trideca-4,6,8,10,12-pentaene |
|---|---|
| PubChem CID | 68865416 |
| Molecular Formula | C9H8N4 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 1,4,5,11-tetrazatricyclo[7.4.0.02,7]trideca-4,6,8,10,12-pentaene |
| SMILES | C1=CN2C(=CC3=CN=NCC32)C=N1 |
| InChI | InChI=1S/C9H8N4/c1-2-13-8(5-10-1)3-7-4-11-12-6-9(7)13/h1-5,9H,6H2 |
| InChIKey | NPFWGMCBYIVSIJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |