C24H32F3NO5 — CID 68866329
6-[2-[3-(1-amino-2-methylpropan-2-yl)phenyl]ethyl]-6-cyclopentyloxane-2,4-dione;2,2,2-trifluoroacetic acid (PubChem CID 68866329) has the molecular formula C24H32F3NO5 and a molecular weight of 471.52 g/mol. Its IUPAC name is 6-[2-[3-(1-amino-2-methylpropan-2-yl)phenyl]ethyl]-6-cyclopentyloxane-2,4-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[2-[3-(1-amino-2-methylpropan-2-yl)phenyl]ethyl]-6-cyclopentyloxane-2,4-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68866329 |
| Molecular Formula | C24H32F3NO5 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 6-[2-[3-(1-amino-2-methylpropan-2-yl)phenyl]ethyl]-6-cyclopentyloxane-2,4-dione;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(CN)c1cccc(CCC2(C3CCCC3)CC(=O)CC(=O)O2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H31NO3.C2HF3O2/c1-21(2,15-23)18-9-5-6-16(12-18)10-11-22(17-7-3-4-8-17)14-19(24)13-20(25)26-22;3-2(4,5)1(6)7/h5-6,9,12,17H,3-4,7-8,10-11,13-15,23H2,1-2H3;(H,6,7) |
| InChIKey | FPNDXJVZFXSZAQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|