C32H38FN5O3 — CID 68866460
2-[4-[2-[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]ethyl]-2-fluorophenyl]-2-ethylbutanenitrile (PubChem CID 68866460) has the molecular formula C32H38FN5O3 and a molecular weight of 559.69 g/mol. Its IUPAC name is 2-[4-[2-[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]ethyl]-2-fluorophenyl]-2-ethylbutanenitrile.
| Compound Name | 2-[4-[2-[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]ethyl]-2-fluorophenyl]-2-ethylbutanenitrile |
|---|---|
| PubChem CID | 68866460 |
| Molecular Formula | C32H38FN5O3 |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | 2-[4-[2-[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]ethyl]-2-fluorophenyl]-2-ethylbutanenitrile |
| SMILES | CCC(C#N)(CC)c1ccc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4nc(C)cc(C)n4n3)C(=O)O2)cc1F |
| InChI | InChI=1S/C32H38FN5O3/c1-5-31(6-2,19-34)25-12-11-22(16-26(25)33)13-14-32(23-9-7-8-10-23)18-27(39)24(29(40)41-32)17-28-36-30-35-20(3)15-21(4)38(30)37-28/h11-12,15-16,23-24H,5-10,13-14,17-18H2,1-4H3 |
| InChIKey | USZWVNBDYYFXBZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 110.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|