C20H32F2O4 — CID 68866839
(3aR,4R,5R,6aS)-4-(3,3-difluorooct-1-enyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 68866839) has the molecular formula C20H32F2O4 and a molecular weight of 374.47 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-(3,3-difluorooct-1-enyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3aR,4R,5R,6aS)-4-(3,3-difluorooct-1-enyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 68866839 |
| Molecular Formula | C20H32F2O4 |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-(3,3-difluorooct-1-enyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCCCC(F)(F)C=C[C@@H]1[C@H]2CC(O)O[C@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C20H32F2O4/c1-2-3-5-9-20(21,22)10-8-14-15-12-18(23)25-17(15)13-16(14)26-19-7-4-6-11-24-19/h8,10,14-19,23H,2-7,9,11-13H2,1H3/t14-,15-,16-,17+,18?,19?/m1/s1 |
| InChIKey | LMAIVZLLHDHYSK-SETITPSXSA-N |
| XLogP | 4.41 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|