About tris(2H-oxazine);1H-phenalene
tris(2H-oxazine);1H-phenalene (PubChem CID 68866882) has the molecular formula C25H25N3O3
and a molecular weight of 415.49 g/mol. Its IUPAC name is tris(2H-oxazine);1H-phenalene.
Molecular Properties
| Compound Name | tris(2H-oxazine);1H-phenalene |
| PubChem CID | 68866882 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | tris(2H-oxazine);1H-phenalene |
| SMILES | C1=CNOC=C1.C1=CNOC=C1.C1=CNOC=C1.C1=Cc2cccc3cccc(c23)C1 |
| InChI | InChI=1S/C13H10.3C4H5NO/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;3*1-2-4-6-5-3-1/h1-8H,9H2;3*1-5H |
| InChIKey | VGVLSQUOOUBKNO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tris(2H-oxazine);1H-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2H-oxazine);1H-phenalene?
The IUPAC name of tris(2H-oxazine);1H-phenalene (CID 68866882) is tris(2H-oxazine);1H-phenalene.
What is the SMILES notation for tris(2H-oxazine);1H-phenalene?
The canonical SMILES for tris(2H-oxazine);1H-phenalene is C1=CNOC=C1.C1=CNOC=C1.C1=CNOC=C1.C1=Cc2cccc3cccc(c23)C1.
What is the InChIKey of tris(2H-oxazine);1H-phenalene?
The InChIKey is VGVLSQUOOUBKNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.3C4H5NO/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;3*1-2-4-6-5-3-1/h1-8H,9H2;3*1-5H.
What are the key properties of tris(2H-oxazine);1H-phenalene?
tris(2H-oxazine);1H-phenalene has a molecular weight of 415.49 g/mol, XLogP of 5.05, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2H-oxazine);1H-phenalene is sourced from PubChem (CID 68866882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).