C8H13F3N4 — CID 68867326
4-(4,4,4-trifluorobutyl)-1H-pyrimidine-2,4-diamine (PubChem CID 68867326) has the molecular formula C8H13F3N4 and a molecular weight of 222.21 g/mol. Its IUPAC name is 4-(4,4,4-trifluorobutyl)-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-(4,4,4-trifluorobutyl)-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68867326 |
| Molecular Formula | C8H13F3N4 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 4-(4,4,4-trifluorobutyl)-1H-pyrimidine-2,4-diamine |
| SMILES | NC1=NC(N)(CCCC(F)(F)F)C=CN1 |
| InChI | InChI=1S/C8H13F3N4/c9-8(10,11)3-1-2-7(13)4-5-14-6(12)15-7/h4-5H,1-3,13H2,(H3,12,14,15) |
| InChIKey | YCNXOSXTJAMIKF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |