About N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;hydrate;dihydrochloride
N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;hydrate;dihydrochloride (PubChem CID 68867493) has the molecular formula C17H24Cl2N2OS
and a molecular weight of 375.37 g/mol. Its IUPAC name is N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;hydrate;dihydrochloride.
Molecular Properties
| Compound Name | N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;hydrate;dihydrochloride |
| PubChem CID | 68867493 |
| Molecular Formula | C17H24Cl2N2OS |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;hydrate;dihydrochloride |
| SMILES | CC(CN1c2ccccc2Sc2ccccc21)N(C)C.Cl.Cl.O |
| InChI | InChI=1S/C17H20N2S.2ClH.H2O/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19;;;/h4-11,13H,12H2,1-3H3;2*1H;1H2 |
| InChIKey | FZGVIBCASZRJHC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 37.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;hydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;hydrate;dihydrochloride?
The IUPAC name of N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;hydrate;dihydrochloride (CID 68867493) is N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;hydrate;dihydrochloride.
What is the SMILES notation for N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;hydrate;dihydrochloride?
The canonical SMILES for N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;hydrate;dihydrochloride is CC(CN1c2ccccc2Sc2ccccc21)N(C)C.Cl.Cl.O.
What is the InChIKey of N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;hydrate;dihydrochloride?
The InChIKey is FZGVIBCASZRJHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2S.2ClH.H2O/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19;;;/h4-11,13H,12H2,1-3H3;2*1H;1H2.
What are the key properties of N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;hydrate;dihydrochloride?
N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;hydrate;dihydrochloride has a molecular weight of 375.37 g/mol, XLogP of 4.26, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine;hydrate;dihydrochloride is sourced from PubChem (CID 68867493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).