C9H13N3 — CID 68867610
5,6,7,8,9,10-hexahydrocycloocta[e][1,2,4]triazine (PubChem CID 68867610) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 5,6,7,8,9,10-hexahydrocycloocta[e][1,2,4]triazine.
| Compound Name | 5,6,7,8,9,10-hexahydrocycloocta[e][1,2,4]triazine |
|---|---|
| PubChem CID | 68867610 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 5,6,7,8,9,10-hexahydrocycloocta[e][1,2,4]triazine |
| SMILES | c1nnc2c(n1)CCCCCC2 |
| InChI | InChI=1S/C9H13N3/c1-2-4-6-9-8(5-3-1)10-7-11-12-9/h7H,1-6H2 |
| InChIKey | CCUFGPZYNXQGQP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |