About oxane-4-carboxamide;hydrochloride
oxane-4-carboxamide;hydrochloride (PubChem CID 68867617) has the molecular formula C6H12ClNO2
and a molecular weight of 165.62 g/mol. Its IUPAC name is oxane-4-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | oxane-4-carboxamide;hydrochloride |
| PubChem CID | 68867617 |
| Molecular Formula | C6H12ClNO2 |
| Molecular Weight | 165.62 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | oxane-4-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)C1CCOCC1 |
| InChI | InChI=1S/C6H11NO2.ClH/c7-6(8)5-1-3-9-4-2-5;/h5H,1-4H2,(H2,7,8);1H |
| InChIKey | YUWYELLNOWOIEC-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.62 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze oxane-4-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxane-4-carboxamide;hydrochloride?
The IUPAC name of oxane-4-carboxamide;hydrochloride (CID 68867617) is oxane-4-carboxamide;hydrochloride.
What is the SMILES notation for oxane-4-carboxamide;hydrochloride?
The canonical SMILES for oxane-4-carboxamide;hydrochloride is Cl.NC(=O)C1CCOCC1.
What is the InChIKey of oxane-4-carboxamide;hydrochloride?
The InChIKey is YUWYELLNOWOIEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.ClH/c7-6(8)5-1-3-9-4-2-5;/h5H,1-4H2,(H2,7,8);1H.
What are the key properties of oxane-4-carboxamide;hydrochloride?
oxane-4-carboxamide;hydrochloride has a molecular weight of 165.62 g/mol, XLogP of 0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxane-4-carboxamide;hydrochloride is sourced from PubChem (CID 68867617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).