C32H47N5O2 — CID 68868840
[2,2,4,4-tetramethyl-1-[2-[[3-methylbutyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]benzimidazol-1-yl]pentan-3-yl]carbamic acid (PubChem CID 68868840) has the molecular formula C32H47N5O2 and a molecular weight of 533.76 g/mol. Its IUPAC name is [2,2,4,4-tetramethyl-1-[2-[[3-methylbutyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]benzimidazol-1-yl]pentan-3-yl]carbamic acid.
| Compound Name | [2,2,4,4-tetramethyl-1-[2-[[3-methylbutyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]benzimidazol-1-yl]pentan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 68868840 |
| Molecular Formula | C32H47N5O2 |
| Molecular Weight | 533.76 g/mol |
| Exact Mass | 533.37 |
| IUPAC Name | [2,2,4,4-tetramethyl-1-[2-[[3-methylbutyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]benzimidazol-1-yl]pentan-3-yl]carbamic acid |
| SMILES | CC(C)CCN(Cc1nc2ccccc2n1CC(C)(C)C(NC(=O)O)C(C)(C)C)C1CCCc2cccnc21 |
| InChI | InChI=1S/C32H47N5O2/c1-22(2)17-19-36(26-16-10-12-23-13-11-18-33-28(23)26)20-27-34-24-14-8-9-15-25(24)37(27)21-32(6,7)29(31(3,4)5)35-30(38)39/h8-9,11,13-15,18,22,26,29,35H,10,12,16-17,19-21H2,1-7H3,(H,38,39) |
| InChIKey | SIRGLZCDAGQMDY-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.76 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |