C22H27F3N3O5PS+2 — CID 68868887
trifluoromethanesulfonamide;1-[4-[1-(2,4,6-trimethylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethylphosphonic acid (PubChem CID 68868887) has the molecular formula C22H27F3N3O5PS+2 and a molecular weight of 533.51 g/mol. Its IUPAC name is trifluoromethanesulfonamide;1-[4-[1-(2,4,6-trimethylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethylphosphonic acid.
| Compound Name | trifluoromethanesulfonamide;1-[4-[1-(2,4,6-trimethylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 68868887 |
| Molecular Formula | C22H27F3N3O5PS+2 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | trifluoromethanesulfonamide;1-[4-[1-(2,4,6-trimethylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethylphosphonic acid |
| SMILES | Cc1cc(C)c(-[n+]2ccc(-c3cc[n+](C(C)P(=O)(O)O)cc3)cc2)c(C)c1.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C21H23N2O3P.CH2F3NO2S/c1-15-13-16(2)21(17(3)14-15)23-11-7-20(8-12-23)19-5-9-22(10-6-19)18(4)27(24,25)26;2-1(3,4)8(5,6)7/h5-14,18H,1-4H3;(H2,5,6,7)/p+2 |
| InChIKey | VZZHBJVBIDKDQA-UHFFFAOYSA-P |
| XLogP | 3.33 |
| TPSA | 125.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|