C14H20N4 — CID 68869550
4,10-dimethyl-13-propyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5,7,10-tetraene (PubChem CID 68869550) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 4,10-dimethyl-13-propyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5,7,10-tetraene.
| Compound Name | 4,10-dimethyl-13-propyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5,7,10-tetraene |
|---|---|
| PubChem CID | 68869550 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 4,10-dimethyl-13-propyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5,7,10-tetraene |
| SMILES | CCCN1CC=C(C)C2=C1N1CN(C)C=C1C=N2 |
| InChI | InChI=1S/C14H20N4/c1-4-6-17-7-5-11(2)13-14(17)18-10-16(3)9-12(18)8-15-13/h5,8-9H,4,6-7,10H2,1-3H3 |
| InChIKey | BFRIQDRTBPPRDB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |