About 5-amino-2-[fluoro-(2,3,4-trifluorophenyl)methoxy]benzoic acid
5-amino-2-[fluoro-(2,3,4-trifluorophenyl)methoxy]benzoic acid (PubChem CID 68869827) has the molecular formula C14H9F4NO3
and a molecular weight of 315.22 g/mol. Its IUPAC name is 5-amino-2-[fluoro-(2,3,4-trifluorophenyl)methoxy]benzoic acid.
Molecular Properties
| Compound Name | 5-amino-2-[fluoro-(2,3,4-trifluorophenyl)methoxy]benzoic acid |
| PubChem CID | 68869827 |
| Molecular Formula | C14H9F4NO3 |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 5-amino-2-[fluoro-(2,3,4-trifluorophenyl)methoxy]benzoic acid |
| SMILES | Nc1ccc(OC(F)c2ccc(F)c(F)c2F)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H9F4NO3/c15-9-3-2-7(11(16)12(9)17)13(18)22-10-4-1-6(19)5-8(10)14(20)21/h1-5,13H,19H2,(H,20,21) |
| InChIKey | PAURMRVUKORTDG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-[fluoro-(2,3,4-trifluorophenyl)methoxy]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-[fluoro-(2,3,4-trifluorophenyl)methoxy]benzoic acid?
The IUPAC name of 5-amino-2-[fluoro-(2,3,4-trifluorophenyl)methoxy]benzoic acid (CID 68869827) is 5-amino-2-[fluoro-(2,3,4-trifluorophenyl)methoxy]benzoic acid.
What is the SMILES notation for 5-amino-2-[fluoro-(2,3,4-trifluorophenyl)methoxy]benzoic acid?
The canonical SMILES for 5-amino-2-[fluoro-(2,3,4-trifluorophenyl)methoxy]benzoic acid is Nc1ccc(OC(F)c2ccc(F)c(F)c2F)c(C(=O)O)c1.
What is the InChIKey of 5-amino-2-[fluoro-(2,3,4-trifluorophenyl)methoxy]benzoic acid?
The InChIKey is PAURMRVUKORTDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F4NO3/c15-9-3-2-7(11(16)12(9)17)13(18)22-10-4-1-6(19)5-8(10)14(20)21/h1-5,13H,19H2,(H,20,21).
What are the key properties of 5-amino-2-[fluoro-(2,3,4-trifluorophenyl)methoxy]benzoic acid?
5-amino-2-[fluoro-(2,3,4-trifluorophenyl)methoxy]benzoic acid has a molecular weight of 315.22 g/mol, XLogP of 3.43, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-[fluoro-(2,3,4-trifluorophenyl)methoxy]benzoic acid is sourced from PubChem (CID 68869827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).