C39H41N2O6+ — CID 68871133
2-[[5-(4-tert-butylphenoxy)-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-1-ium-1-carbonyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 68871133) has the molecular formula C39H41N2O6+ and a molecular weight of 633.77 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenoxy)-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-1-ium-1-carbonyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 2-[[5-(4-tert-butylphenoxy)-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-1-ium-1-carbonyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 68871133 |
| Molecular Formula | C39H41N2O6+ |
| Molecular Weight | 633.77 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | 2-[[5-(4-tert-butylphenoxy)-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-1-ium-1-carbonyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | CC(C)(C)OC(=O)[N+]1(C(=O)NC(Cc2ccc(-c3ccccc3)cc2)C(=O)O)C=Cc2cc(Oc3ccc(C(C)(C)C)cc3)ccc21 |
| InChI | InChI=1S/C39H40N2O6/c1-38(2,3)30-16-18-31(19-17-30)46-32-20-21-34-29(25-32)22-23-41(34,37(45)47-39(4,5)6)36(44)40-33(35(42)43)24-26-12-14-28(15-13-26)27-10-8-7-9-11-27/h7-23,25,33H,24H2,1-6H3,(H-,40,42,43,44)/p+1 |
| InChIKey | GYIPUMZRSVKOAK-UHFFFAOYSA-O |
| XLogP | 9.08 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.77 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|