C39H43N5 — CID 68871407
[4-(2,8,13,17-tetraethyl-3,7,12,18-tetramethylporphyrin-5-yl)phenyl]methanamine (PubChem CID 68871407) has the molecular formula C39H43N5 and a molecular weight of 581.81 g/mol. Its IUPAC name is [4-(2,8,13,17-tetraethyl-3,7,12,18-tetramethylporphyrin-5-yl)phenyl]methanamine.
| Compound Name | [4-(2,8,13,17-tetraethyl-3,7,12,18-tetramethylporphyrin-5-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 68871407 |
| Molecular Formula | C39H43N5 |
| Molecular Weight | 581.81 g/mol |
| Exact Mass | 581.35 |
| IUPAC Name | [4-(2,8,13,17-tetraethyl-3,7,12,18-tetramethylporphyrin-5-yl)phenyl]methanamine |
| SMILES | CCC1=C(C)/C2=C/C3=N/C(=C(/c4ccc(CN)cc4)C4=N/C(=C\C5=N/C(=C\C1=N2)C(CC)=C5C)C(CC)=C4C)C(C)=C3CC |
| InChI | InChI=1S/C39H43N5/c1-9-27-21(5)31-17-35-29(11-3)23(7)38(43-35)37(26-15-13-25(20-40)14-16-26)39-24(8)30(12-4)36(44-39)18-32-22(6)28(10-2)34(42-32)19-33(27)41-31/h13-19H,9-12,20,40H2,1-8H3/b31-17-,32-18-,33-19-,34-19-,35-17-,36-18-,38-37-,39-37- |
| InChIKey | AHWRNQVOOAZEIX-DJJAMZPWSA-N |
| XLogP | 9.25 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.81 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |