About (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol
(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol (PubChem CID 68871695) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol.
Molecular Properties
| Compound Name | (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol |
| PubChem CID | 68871695 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol |
| SMILES | CN1[C@@H]2CC(O)C[C@H]1C(O)C2 |
| InChI | InChI=1S/C8H15NO2/c1-9-5-2-6(10)4-7(9)8(11)3-5/h5-8,10-11H,2-4H2,1H3/t5-,6?,7+,8?/m1/s1 |
| InChIKey | QWVUOVZJBNQSNS-RRABCLCVSA-N |
| XLogP | -0.43 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol?
The IUPAC name of (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol (CID 68871695) is (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol.
What is the SMILES notation for (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol?
The canonical SMILES for (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol is CN1[C@@H]2CC(O)C[C@H]1C(O)C2.
What is the InChIKey of (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol?
The InChIKey is QWVUOVZJBNQSNS-RRABCLCVSA-N. The full InChI is InChI=1S/C8H15NO2/c1-9-5-2-6(10)4-7(9)8(11)3-5/h5-8,10-11H,2-4H2,1H3/t5-,6?,7+,8?/m1/s1.
What are the key properties of (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol?
(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol has a molecular weight of 157.21 g/mol, XLogP of -0.43, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol is sourced from PubChem (CID 68871695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).