C10H13N5 — CID 6887199
(E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(1-methylpyrrol-2-yl)methanimine (PubChem CID 6887199) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is (E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(1-methylpyrrol-2-yl)methanimine.
| Compound Name | (E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(1-methylpyrrol-2-yl)methanimine |
|---|---|
| PubChem CID | 6887199 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(1-methylpyrrol-2-yl)methanimine |
| SMILES | Cc1nnc(C)n1/N=C/c1cccn1C |
| InChI | InChI=1S/C10H13N5/c1-8-12-13-9(2)15(8)11-7-10-5-4-6-14(10)3/h4-7H,1-3H3/b11-7+ |
| InChIKey | QQHSJAXVSGPZGA-YRNVUSSQSA-N |
| XLogP | 1.12 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|