C23H26N8O5S — CID 68872119
3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethylimidazo[4,5-c]pyridin-6-yl]oxy-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]benzamide (PubChem CID 68872119) has the molecular formula C23H26N8O5S and a molecular weight of 526.58 g/mol. Its IUPAC name is 3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethylimidazo[4,5-c]pyridin-6-yl]oxy-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]benzamide.
| Compound Name | 3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethylimidazo[4,5-c]pyridin-6-yl]oxy-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 68872119 |
| Molecular Formula | C23H26N8O5S |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethylimidazo[4,5-c]pyridin-6-yl]oxy-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]benzamide |
| SMILES | CCn1c(-c2nonc2N)nc2cnc(Oc3cccc(C(=O)NCCN4CCS(=O)(=O)CC4)c3)cc21 |
| InChI | InChI=1S/C23H26N8O5S/c1-2-31-18-13-19(26-14-17(18)27-22(31)20-21(24)29-36-28-20)35-16-5-3-4-15(12-16)23(32)25-6-7-30-8-10-37(33,34)11-9-30/h3-5,12-14H,2,6-11H2,1H3,(H2,24,29)(H,25,32) |
| InChIKey | XEZCRWAKGHQLQM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 171.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |