C27H30N2O4 — CID 68872140
methyl 2-[[4-[3-[ethyl(2-pyridin-2-ylethyl)amino]-3-oxopropyl]phenoxy]methyl]benzoate (PubChem CID 68872140) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is methyl 2-[[4-[3-[ethyl(2-pyridin-2-ylethyl)amino]-3-oxopropyl]phenoxy]methyl]benzoate.
| Compound Name | methyl 2-[[4-[3-[ethyl(2-pyridin-2-ylethyl)amino]-3-oxopropyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 68872140 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | methyl 2-[[4-[3-[ethyl(2-pyridin-2-ylethyl)amino]-3-oxopropyl]phenoxy]methyl]benzoate |
| SMILES | CCN(CCc1ccccn1)C(=O)CCc1ccc(OCc2ccccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C27H30N2O4/c1-3-29(19-17-23-9-6-7-18-28-23)26(30)16-13-21-11-14-24(15-12-21)33-20-22-8-4-5-10-25(22)27(31)32-2/h4-12,14-15,18H,3,13,16-17,19-20H2,1-2H3 |
| InChIKey | NXRIXBJDTIUECM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |